C41H49FO7 — CID 88894222
[4-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]phenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate (PubChem CID 88894222) has the molecular formula C41H49FO7 and a molecular weight of 672.83 g/mol. Its IUPAC name is [4-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]phenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate.
| Compound Name | [4-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]phenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 88894222 |
| Molecular Formula | C41H49FO7 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | [4-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylphenyl]phenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
| SMILES | CCCC(OCC1CCC2OC2C1)Oc1ccc(C(=O)Oc2ccc(-c3ccc(C(=O)OC4CC(C)CCC4C(C)C)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C41H49FO7/c1-5-6-39(45-24-27-8-20-36-38(22-27)48-36)46-32-17-19-34(35(42)23-32)41(44)47-31-15-13-29(14-16-31)28-9-11-30(12-10-28)40(43)49-37-21-26(4)7-18-33(37)25(2)3/h9-17,19,23,25-27,33,36-39H,5-8,18,20-22,24H2,1-4H3 |
| InChIKey | VBHDGVHALILCST-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|