C46H52O10 — CID 88957932
[6-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxynaphthalen-2-yl] 4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate (PubChem CID 88957932) has the molecular formula C46H52O10 and a molecular weight of 764.91 g/mol. Its IUPAC name is [6-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxynaphthalen-2-yl] 4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate.
| Compound Name | [6-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxynaphthalen-2-yl] 4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 88957932 |
| Molecular Formula | C46H52O10 |
| Molecular Weight | 764.91 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | [6-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxynaphthalen-2-yl] 4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
| SMILES | CCCC(OCC1CCC2OC2C1)Oc1ccc(C(=O)Oc2ccc3cc(OC(=O)c4ccc(OC(CCC)OCC5CCC6OC6C5)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C46H52O10/c1-3-5-43(49-27-29-7-21-39-41(23-29)55-39)51-35-15-9-31(10-16-35)45(47)53-37-19-13-34-26-38(20-14-33(34)25-37)54-46(48)32-11-17-36(18-12-32)52-44(6-4-2)50-28-30-8-22-40-42(24-30)56-40/h9-20,25-26,29-30,39-44H,3-8,21-24,27-28H2,1-2H3 |
| InChIKey | KEYXVTNMDLNFHS-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.91 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|