C32H38O8 — CID 58220368
[3-methyl-4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxyphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 58220368) has the molecular formula C32H38O8 and a molecular weight of 550.65 g/mol. Its IUPAC name is [3-methyl-4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxyphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [3-methyl-4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxyphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 58220368 |
| Molecular Formula | C32H38O8 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [3-methyl-4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxyphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | Cc1cc(OC(=O)C2CCC3OC3C2)ccc1OC(=O)c1ccc(OCCCCOCC2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C32H38O8/c1-20-16-25(37-32(34)23-7-12-28-30(18-23)39-28)10-13-26(20)40-31(33)22-5-8-24(9-6-22)36-15-3-2-14-35-19-21-4-11-27-29(17-21)38-27/h5-6,8-10,13,16,21,23,27-30H,2-4,7,11-12,14-15,17-19H2,1H3 |
| InChIKey | OOBSZCXQZCYLMZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|