C31H36O8 — CID 58220286
[4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 58220286) has the molecular formula C31H36O8 and a molecular weight of 536.62 g/mol. Its IUPAC name is [4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 58220286 |
| Molecular Formula | C31H36O8 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | O=C(Oc1ccc(OCCCCOCC2CCC3OC3C2)cc1)c1ccc(OC(=O)C2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C31H36O8/c32-30(21-4-7-24(8-5-21)37-31(33)22-6-14-27-29(18-22)39-27)36-25-11-9-23(10-12-25)35-16-2-1-15-34-19-20-3-13-26-28(17-20)38-26/h4-5,7-12,20,22,26-29H,1-3,6,13-19H2 |
| InChIKey | BYGRSVVZXXWDQG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|