C42H48O11 — CID 76790607
[4-[2-[3-[4-(oxiran-2-ylmethoxy)phenyl]prop-2-enoyloxy]propoxycarbonyl]phenyl] 4-[6-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)hexoxy]benzoate (PubChem CID 76790607) has the molecular formula C42H48O11 and a molecular weight of 728.84 g/mol. Its IUPAC name is [4-[2-[3-[4-(oxiran-2-ylmethoxy)phenyl]prop-2-enoyloxy]propoxycarbonyl]phenyl] 4-[6-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)hexoxy]benzoate.
| Compound Name | [4-[2-[3-[4-(oxiran-2-ylmethoxy)phenyl]prop-2-enoyloxy]propoxycarbonyl]phenyl] 4-[6-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 76790607 |
| Molecular Formula | C42H48O11 |
| Molecular Weight | 728.84 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | [4-[2-[3-[4-(oxiran-2-ylmethoxy)phenyl]prop-2-enoyloxy]propoxycarbonyl]phenyl] 4-[6-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)hexoxy]benzoate |
| SMILES | CC(COC(=O)c1ccc(OC(=O)c2ccc(OCCCCCCOCC3CCC4OC4C3)cc2)cc1)OC(=O)C=Cc1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C42H48O11/c1-29(51-40(43)21-9-30-6-14-35(15-7-30)48-27-37-28-49-37)25-50-41(44)32-12-18-36(19-13-32)52-42(45)33-10-16-34(17-11-33)47-23-5-3-2-4-22-46-26-31-8-20-38-39(24-31)53-38/h6-7,9-19,21,29,31,37-39H,2-5,8,20,22-28H2,1H3 |
| InChIKey | QQHQJVXWGLUREA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 131.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.84 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|