C59H50O9 — CID 58453477
[1-[2-[4-[4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzoyl]oxybenzoyl]oxynaphthalen-1-yl]naphthalen-2-yl] 4-methylbenzoate (PubChem CID 58453477) has the molecular formula C59H50O9 and a molecular weight of 903.04 g/mol. Its IUPAC name is [1-[2-[4-[4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzoyl]oxybenzoyl]oxynaphthalen-1-yl]naphthalen-2-yl] 4-methylbenzoate.
| Compound Name | [1-[2-[4-[4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzoyl]oxybenzoyl]oxynaphthalen-1-yl]naphthalen-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 58453477 |
| Molecular Formula | C59H50O9 |
| Molecular Weight | 903.04 g/mol |
| Exact Mass | 902.35 |
| IUPAC Name | [1-[2-[4-[4-[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzoyl]oxybenzoyl]oxynaphthalen-1-yl]naphthalen-2-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3ccccc3c2-c2c(OC(=O)c3ccc(OC(=O)c4ccc(-c5ccc(OCCCCOCC6CCC7OC7C6)cc5)cc4)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C59H50O9/c1-38-12-15-44(16-13-38)58(61)67-52-32-25-42-8-2-4-10-49(42)55(52)56-50-11-5-3-9-43(50)26-33-53(56)68-59(62)46-23-29-48(30-24-46)65-57(60)45-19-17-40(18-20-45)41-21-27-47(28-22-41)64-35-7-6-34-63-37-39-14-31-51-54(36-39)66-51/h2-5,8-13,15-30,32-33,39,51,54H,6-7,14,31,34-37H2,1H3 |
| InChIKey | LXNRTFZVRCVVJK-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 109.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.04 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|