C43H36FNO7 — CID 134189535
[2-fluoro-4-[2-methanimidoyl-4-(2-phenylethynyl)phenoxy]carbonylphenyl] 6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalene-2-carboxylate (PubChem CID 134189535) has the molecular formula C43H36FNO7 and a molecular weight of 697.76 g/mol. Its IUPAC name is [2-fluoro-4-[2-methanimidoyl-4-(2-phenylethynyl)phenoxy]carbonylphenyl] 6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalene-2-carboxylate.
| Compound Name | [2-fluoro-4-[2-methanimidoyl-4-(2-phenylethynyl)phenoxy]carbonylphenyl] 6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 134189535 |
| Molecular Formula | C43H36FNO7 |
| Molecular Weight | 697.76 g/mol |
| Exact Mass | 697.25 |
| IUPAC Name | [2-fluoro-4-[2-methanimidoyl-4-(2-phenylethynyl)phenoxy]carbonylphenyl] 6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalene-2-carboxylate |
| SMILES | [H]/N=C/c1cc(C#Cc2ccccc2)ccc1OC(=O)c1ccc(OC(=O)c2ccc3cc(OCCCOCC4CCC5OC5C4)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C43H36FNO7/c44-37-25-34(43(47)51-38-16-9-29(21-35(38)26-45)8-7-28-5-2-1-3-6-28)14-18-39(37)52-42(46)33-12-11-32-24-36(15-13-31(32)23-33)49-20-4-19-48-27-30-10-17-40-41(22-30)50-40/h1-3,5-6,9,11-16,18,21,23-26,30,40-41,45H,4,10,17,19-20,22,27H2/b45-26+ |
| InChIKey | VDSQDOWITBJPGU-JJHRWBALSA-N |
| XLogP | 8.17 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.76 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|