C41H37NO9 — CID 134189527
[4-[2-[4-(4-ethenoxybenzoyl)oxy-3-methanimidoylphenyl]ethyl]-2-methoxyphenyl] 6-[3-(oxiran-2-yloxy)propoxy]naphthalene-2-carboxylate (PubChem CID 134189527) has the molecular formula C41H37NO9 and a molecular weight of 687.75 g/mol. Its IUPAC name is [4-[2-[4-(4-ethenoxybenzoyl)oxy-3-methanimidoylphenyl]ethyl]-2-methoxyphenyl] 6-[3-(oxiran-2-yloxy)propoxy]naphthalene-2-carboxylate.
| Compound Name | [4-[2-[4-(4-ethenoxybenzoyl)oxy-3-methanimidoylphenyl]ethyl]-2-methoxyphenyl] 6-[3-(oxiran-2-yloxy)propoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 134189527 |
| Molecular Formula | C41H37NO9 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | [4-[2-[4-(4-ethenoxybenzoyl)oxy-3-methanimidoylphenyl]ethyl]-2-methoxyphenyl] 6-[3-(oxiran-2-yloxy)propoxy]naphthalene-2-carboxylate |
| SMILES | [H]/N=C/c1cc(CCc2ccc(OC(=O)c3ccc4cc(OCCCOC5CO5)ccc4c3)c(OC)c2)ccc1OC(=O)c1ccc(OC=C)cc1 |
| InChI | InChI=1S/C41H37NO9/c1-3-46-34-14-11-29(12-15-34)40(43)50-36-17-7-27(21-33(36)25-42)5-6-28-8-18-37(38(22-28)45-2)51-41(44)32-10-9-31-24-35(16-13-30(31)23-32)47-19-4-20-48-39-26-49-39/h3,7-18,21-25,39,42H,1,4-6,19-20,26H2,2H3/b42-25+ |
| InChIKey | HBUAZGXHVDYDET-QYXAQCCZSA-N |
| XLogP | 7.73 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|