C30H21NO10 — CID 122419007
[2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate (PubChem CID 122419007) has the molecular formula C30H21NO10 and a molecular weight of 555.50 g/mol. Its IUPAC name is [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate.
| Compound Name | [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 122419007 |
| Molecular Formula | C30H21NO10 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate |
| SMILES | [H]/N=C/c1cc(OC(=O)c2ccc(OC(=O)C=C)cc2)ccc1OC(=O)c1ccc(OC(=O)C=C)c(OC(=O)C=C)c1 |
| InChI | InChI=1S/C30H21NO10/c1-4-26(32)37-21-10-7-18(8-11-21)29(35)38-22-12-14-23(20(15-22)17-31)41-30(36)19-9-13-24(39-27(33)5-2)25(16-19)40-28(34)6-3/h4-17,31H,1-3H2/b31-17+ |
| InChIKey | QCYKGQBGNMPXPB-KBVAKVRCSA-N |
| XLogP | 4.40 |
| TPSA | 155.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|