C35H34O11 — CID 134548222
[4-[4-[6-(1-hydroxyprop-2-enoxy)hexoxy]benzoyl]oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate (PubChem CID 134548222) has the molecular formula C35H34O11 and a molecular weight of 630.65 g/mol. Its IUPAC name is [4-[4-[6-(1-hydroxyprop-2-enoxy)hexoxy]benzoyl]oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate.
| Compound Name | [4-[4-[6-(1-hydroxyprop-2-enoxy)hexoxy]benzoyl]oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 134548222 |
| Molecular Formula | C35H34O11 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | [4-[4-[6-(1-hydroxyprop-2-enoxy)hexoxy]benzoyl]oxyphenyl] 3,4-di(prop-2-enoyloxy)benzoate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC(O)C=C)cc3)cc2)cc1OC(=O)C=C |
| InChI | InChI=1S/C35H34O11/c1-4-31(36)42-22-10-8-7-9-21-41-26-14-11-24(12-15-26)34(39)43-27-16-18-28(19-17-27)44-35(40)25-13-20-29(45-32(37)5-2)30(23-25)46-33(38)6-3/h4-6,11-20,23,31,36H,1-3,7-10,21-22H2 |
| InChIKey | RYYNYSDMVDARPU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|