C25H23NO8 — CID 145312760
4-O-(4-formyloxy-2-methanimidoylphenyl) 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 145312760) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is 4-O-(4-formyloxy-2-methanimidoylphenyl) 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(4-formyloxy-2-methanimidoylphenyl) 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 145312760 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-O-(4-formyloxy-2-methanimidoylphenyl) 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | [H]/N=C/c1cc(OC=O)ccc1OC(=O)C1CCC(C(=O)Oc2ccc(OC(=O)C=C)cc2)CC1 |
| InChI | InChI=1S/C25H23NO8/c1-2-23(28)32-19-7-9-20(10-8-19)33-24(29)16-3-5-17(6-4-16)25(30)34-22-12-11-21(31-15-27)13-18(22)14-26/h2,7-17,26H,1,3-6H2/b26-14+ |
| InChIKey | DKDCJDRGFPPIOD-VULFUBBASA-N |
| XLogP | 3.63 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|