C48H48N2O12S2 — CID 145093780
3H-1,2,3-benzodithiazole;4-O-[4-(4-formylcyclohexanecarbonyl)oxy-3-methanimidoylphenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate;(4-methoxyphenyl) prop-2-enoate (PubChem CID 145093780) has the molecular formula C48H48N2O12S2 and a molecular weight of 909.05 g/mol. Its IUPAC name is 3H-1,2,3-benzodithiazole;4-O-[4-(4-formylcyclohexanecarbonyl)oxy-3-methanimidoylphenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate;(4-methoxyphenyl) prop-2-enoate.
| Compound Name | 3H-1,2,3-benzodithiazole;4-O-[4-(4-formylcyclohexanecarbonyl)oxy-3-methanimidoylphenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate;(4-methoxyphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 145093780 |
| Molecular Formula | C48H48N2O12S2 |
| Molecular Weight | 909.05 g/mol |
| Exact Mass | 908.26 |
| IUPAC Name | 3H-1,2,3-benzodithiazole;4-O-[4-(4-formylcyclohexanecarbonyl)oxy-3-methanimidoylphenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate;(4-methoxyphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(OC)cc1.[H]/N=C/c1cc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)C=C)cc3)CC2)ccc1OC(=O)C1CCC(C=O)CC1.c1ccc2c(c1)NSS2 |
| InChI | InChI=1S/C32H33NO9.C10H10O3.C6H5NS2/c1-2-29(35)39-25-11-13-26(14-12-25)40-30(36)22-7-9-23(10-8-22)31(37)41-27-15-16-28(24(17-27)18-33)42-32(38)21-5-3-20(19-34)4-6-21;1-3-10(11)13-9-6-4-8(12-2)5-7-9;1-2-4-6-5(3-1)7-9-8-6/h2,11-23,33H,1,3-10H2;3-7H,1H2,2H3;1-4,7H/b33-18+;; |
| InChIKey | NZDZLIJBTMAFPI-JIWSEDNVSA-N |
| XLogP | 9.56 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.05 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|