C24H29N3O4S — CID 166998020
[3-[[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2-methylhydrazinyl]methyl]-4-methoxyphenyl] 4-formylcyclohexane-1-carboxylate (PubChem CID 166998020) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is [3-[[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2-methylhydrazinyl]methyl]-4-methoxyphenyl] 4-formylcyclohexane-1-carboxylate.
| Compound Name | [3-[[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2-methylhydrazinyl]methyl]-4-methoxyphenyl] 4-formylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166998020 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [3-[[2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2-methylhydrazinyl]methyl]-4-methoxyphenyl] 4-formylcyclohexane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CCC(C=O)CC2)cc1CNN(C)C1Nc2ccccc2S1 |
| InChI | InChI=1S/C24H29N3O4S/c1-27(24-26-20-5-3-4-6-22(20)32-24)25-14-18-13-19(11-12-21(18)30-2)31-23(29)17-9-7-16(15-28)8-10-17/h3-6,11-13,15-17,24-26H,7-10,14H2,1-2H3 |
| InChIKey | SVMLZISYQIKZJA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|