C16H20O3 — CID 163436985
(4-ethylphenyl) 4-formylcyclohexane-1-carboxylate (PubChem CID 163436985) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (4-ethylphenyl) 4-formylcyclohexane-1-carboxylate.
| Compound Name | (4-ethylphenyl) 4-formylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163436985 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4-ethylphenyl) 4-formylcyclohexane-1-carboxylate |
| SMILES | CCc1ccc(OC(=O)C2CCC(C=O)CC2)cc1 |
| InChI | InChI=1S/C16H20O3/c1-2-12-5-9-15(10-6-12)19-16(18)14-7-3-13(11-17)4-8-14/h5-6,9-11,13-14H,2-4,7-8H2,1H3 |
| InChIKey | BQKGHGBQXIHPDF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|