C34H46O5 — CID 145298497
(4-pentylphenyl) 4-[[4-[(4-formylcyclohexyl)methoxy]-2-methylphenoxy]methyl]cyclohexane-1-carboxylate (PubChem CID 145298497) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is (4-pentylphenyl) 4-[[4-[(4-formylcyclohexyl)methoxy]-2-methylphenoxy]methyl]cyclohexane-1-carboxylate.
| Compound Name | (4-pentylphenyl) 4-[[4-[(4-formylcyclohexyl)methoxy]-2-methylphenoxy]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 145298497 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | (4-pentylphenyl) 4-[[4-[(4-formylcyclohexyl)methoxy]-2-methylphenoxy]methyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCc1ccc(OC(=O)C2CCC(COc3ccc(OCC4CCC(C=O)CC4)cc3C)CC2)cc1 |
| InChI | InChI=1S/C34H46O5/c1-3-4-5-6-26-13-17-31(18-14-26)39-34(36)30-15-11-29(12-16-30)24-38-33-20-19-32(21-25(33)2)37-23-28-9-7-27(22-35)8-10-28/h13-14,17-22,27-30H,3-12,15-16,23-24H2,1-2H3 |
| InChIKey | ONVKLBBDSLFEOR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|