C32H46O2 — CID 102533321
[4-(3-methyl-5-octylphenyl)phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 102533321) has the molecular formula C32H46O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is [4-(3-methyl-5-octylphenyl)phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(3-methyl-5-octylphenyl)phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 102533321 |
| Molecular Formula | C32H46O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | [4-(3-methyl-5-octylphenyl)phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCc1cc(C)cc(-c2ccc(OC(=O)C3CCC(CCCC)CC3)cc2)c1 |
| InChI | InChI=1S/C32H46O2/c1-4-6-8-9-10-11-13-27-22-25(3)23-30(24-27)28-18-20-31(21-19-28)34-32(33)29-16-14-26(15-17-29)12-7-5-2/h18-24,26,29H,4-17H2,1-3H3 |
| InChIKey | VOZFIHXRJHRTRO-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|