C26H30O8 — CID 159835979
bis[4-(acetyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate;molecular hydrogen (PubChem CID 159835979) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is bis[4-(acetyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate;molecular hydrogen.
| Compound Name | bis[4-(acetyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 159835979 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | bis[4-(acetyloxymethyl)phenyl] cyclohexane-1,4-dicarboxylate;molecular hydrogen |
| SMILES | CC(=O)OCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(COC(C)=O)cc3)CC2)cc1.[H][H] |
| InChI | InChI=1S/C26H28O8.H2/c1-17(27)31-15-19-3-11-23(12-4-19)33-25(29)21-7-9-22(10-8-21)26(30)34-24-13-5-20(6-14-24)16-32-18(2)28;/h3-6,11-14,21-22H,7-10,15-16H2,1-2H3;1H |
| InChIKey | NOBQTTLKGUIDAE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|