C13H17NO2 — CID 170864830
[4-(2-aminopropyl)phenyl] cyclopropanecarboxylate (PubChem CID 170864830) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is [4-(2-aminopropyl)phenyl] cyclopropanecarboxylate.
| Compound Name | [4-(2-aminopropyl)phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 170864830 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [4-(2-aminopropyl)phenyl] cyclopropanecarboxylate |
| SMILES | CC(N)Cc1ccc(OC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-9(14)8-10-2-6-12(7-3-10)16-13(15)11-4-5-11/h2-3,6-7,9,11H,4-5,8,14H2,1H3 |
| InChIKey | YTFXLQRUJHDYMB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|