C39H53N3O4S — CID 146341327
[(1R)-cyclohept-3-en-1-yl] 4-(cyclohexanecarbonyloxy)-2-[(E)-[2,3-dihydro-1,3-benzothiazol-2-yl(7-methylnonyl)hydrazinylidene]methyl]benzoate (PubChem CID 146341327) has the molecular formula C39H53N3O4S and a molecular weight of 659.94 g/mol. Its IUPAC name is [(1R)-cyclohept-3-en-1-yl] 4-(cyclohexanecarbonyloxy)-2-[(E)-[2,3-dihydro-1,3-benzothiazol-2-yl(7-methylnonyl)hydrazinylidene]methyl]benzoate.
| Compound Name | [(1R)-cyclohept-3-en-1-yl] 4-(cyclohexanecarbonyloxy)-2-[(E)-[2,3-dihydro-1,3-benzothiazol-2-yl(7-methylnonyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 146341327 |
| Molecular Formula | C39H53N3O4S |
| Molecular Weight | 659.94 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | [(1R)-cyclohept-3-en-1-yl] 4-(cyclohexanecarbonyloxy)-2-[(E)-[2,3-dihydro-1,3-benzothiazol-2-yl(7-methylnonyl)hydrazinylidene]methyl]benzoate |
| SMILES | CCC(C)CCCCCCN(/N=C/c1cc(OC(=O)C2CCCCC2)ccc1C(=O)O[C@H]1CC=CCCC1)C1Nc2ccccc2S1 |
| InChI | InChI=1S/C39H53N3O4S/c1-3-29(2)17-9-6-7-16-26-42(39-41-35-22-14-15-23-36(35)47-39)40-28-31-27-33(46-37(43)30-18-10-8-11-19-30)24-25-34(31)38(44)45-32-20-12-4-5-13-21-32/h4,12,14-15,22-25,27-30,32,39,41H,3,5-11,13,16-21,26H2,1-2H3/b40-28+/t29?,32-,39?/m0/s1 |
| InChIKey | UMYANICRPUGDCG-ZQAYNMKZSA-N |
| XLogP | 9.96 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.94 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|