C43H42N2O7 — CID 139447124
4-O-[3-[(E)-[(E)-anthracen-9-ylmethylidenehydrazinylidene]methyl]-4-(2-methylpropanoyloxy)phenyl] 1-O-(4-propoxyphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 139447124) has the molecular formula C43H42N2O7 and a molecular weight of 698.82 g/mol. Its IUPAC name is 4-O-[3-[(E)-[(E)-anthracen-9-ylmethylidenehydrazinylidene]methyl]-4-(2-methylpropanoyloxy)phenyl] 1-O-(4-propoxyphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[3-[(E)-[(E)-anthracen-9-ylmethylidenehydrazinylidene]methyl]-4-(2-methylpropanoyloxy)phenyl] 1-O-(4-propoxyphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139447124 |
| Molecular Formula | C43H42N2O7 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 4-O-[3-[(E)-[(E)-anthracen-9-ylmethylidenehydrazinylidene]methyl]-4-(2-methylpropanoyloxy)phenyl] 1-O-(4-propoxyphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | CCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)C(C)C)c(/C=N/N=C/c4c5ccccc5cc5ccccc45)c3)CC2)cc1 |
| InChI | InChI=1S/C43H42N2O7/c1-4-23-49-34-17-19-35(20-18-34)50-42(47)29-13-15-30(16-14-29)43(48)51-36-21-22-40(52-41(46)28(2)3)33(25-36)26-44-45-27-39-37-11-7-5-9-31(37)24-32-10-6-8-12-38(32)39/h5-12,17-22,24-30H,4,13-16,23H2,1-3H3/b44-26+,45-27+ |
| InChIKey | ZUCJTYMCRWSKFN-FYAXVHQVSA-N |
| XLogP | 9.11 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|