C54H52N2O10 — CID 123309807
[3-[(anthracen-9-ylmethylidenehydrazinylidene)methyl]-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 123309807) has the molecular formula C54H52N2O10 and a molecular weight of 889.01 g/mol. Its IUPAC name is [3-[(anthracen-9-ylmethylidenehydrazinylidene)methyl]-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [3-[(anthracen-9-ylmethylidenehydrazinylidene)methyl]-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 123309807 |
| Molecular Formula | C54H52N2O10 |
| Molecular Weight | 889.01 g/mol |
| Exact Mass | 888.36 |
| IUPAC Name | [3-[(anthracen-9-ylmethylidenehydrazinylidene)methyl]-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)c(C=NN=Cc3c4ccccc4cc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C54H52N2O10/c1-3-51(57)63-33-15-7-5-13-31-61-44-25-21-39(22-26-44)53(59)65-46-29-30-50(66-54(60)40-23-27-45(28-24-40)62-32-14-6-8-16-34-64-52(58)4-2)43(36-46)37-55-56-38-49-47-19-11-9-17-41(47)35-42-18-10-12-20-48(42)49/h3-4,9-12,17-30,35-38H,1-2,5-8,13-16,31-34H2 |
| InChIKey | QRPHYDYIQSBHAH-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.01 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|