C52H52N2O10 — CID 172964318
[3-[(E)-(fluoren-9-ylidenehydrazinylidene)methyl]-4-[hydroxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 172964318) has the molecular formula C52H52N2O10 and a molecular weight of 864.99 g/mol. Its IUPAC name is [3-[(E)-(fluoren-9-ylidenehydrazinylidene)methyl]-4-[hydroxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [3-[(E)-(fluoren-9-ylidenehydrazinylidene)methyl]-4-[hydroxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 172964318 |
| Molecular Formula | C52H52N2O10 |
| Molecular Weight | 864.99 g/mol |
| Exact Mass | 864.36 |
| IUPAC Name | [3-[(E)-(fluoren-9-ylidenehydrazinylidene)methyl]-4-[hydroxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(O)c3ccc(OCCCCCCOC(=O)C=C)cc3)c(/C=N/N=C3c4ccccc4-c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C52H52N2O10/c1-3-48(55)61-33-15-7-5-13-31-59-40-25-21-37(22-26-40)51(57)63-42-29-30-47(39(35-42)36-53-54-50-45-19-11-9-17-43(45)44-18-10-12-20-46(44)50)64-52(58)38-23-27-41(28-24-38)60-32-14-6-8-16-34-62-49(56)4-2/h3-4,9-12,17-30,35-36,52,58H,1-2,5-8,13-16,31-34H2/b53-36+ |
| InChIKey | QQDDAUZURAEENQ-OHKKMKJPSA-N |
| XLogP | 10.16 |
| TPSA | 151.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.99 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|