C33H31NO7 — CID 145123330
(6-formylnaphthalen-2-yl) 3-methanimidoyl-4-(3-prop-2-enoyloxypropoxy)benzoate;1-methoxy-4-methylbenzene (PubChem CID 145123330) has the molecular formula C33H31NO7 and a molecular weight of 553.61 g/mol. Its IUPAC name is (6-formylnaphthalen-2-yl) 3-methanimidoyl-4-(3-prop-2-enoyloxypropoxy)benzoate;1-methoxy-4-methylbenzene.
| Compound Name | (6-formylnaphthalen-2-yl) 3-methanimidoyl-4-(3-prop-2-enoyloxypropoxy)benzoate;1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 145123330 |
| Molecular Formula | C33H31NO7 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | (6-formylnaphthalen-2-yl) 3-methanimidoyl-4-(3-prop-2-enoyloxypropoxy)benzoate;1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C)cc1.[H]/N=C/c1cc(C(=O)Oc2ccc3cc(C=O)ccc3c2)ccc1OCCCOC(=O)C=C |
| InChI | InChI=1S/C25H21NO6.C8H10O/c1-2-24(28)31-11-3-10-30-23-9-7-20(13-21(23)15-26)25(29)32-22-8-6-18-12-17(16-27)4-5-19(18)14-22;1-7-3-5-8(9-2)6-4-7/h2,4-9,12-16,26H,1,3,10-11H2;3-6H,1-2H3/b26-15+; |
| InChIKey | UBKLKSANOPYOGS-UUXIZDQESA-N |
| XLogP | 6.37 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|