C41H41NO7 — CID 145298479
[2-[(4-ethenoxyphenyl)methoxy]-5-[2-[3-methoxy-4-[[6-[3-(oxiran-2-yloxy)propoxy]naphthalen-2-yl]methoxy]phenyl]ethyl]phenyl]methanimine (PubChem CID 145298479) has the molecular formula C41H41NO7 and a molecular weight of 659.78 g/mol. Its IUPAC name is [2-[(4-ethenoxyphenyl)methoxy]-5-[2-[3-methoxy-4-[[6-[3-(oxiran-2-yloxy)propoxy]naphthalen-2-yl]methoxy]phenyl]ethyl]phenyl]methanimine.
| Compound Name | [2-[(4-ethenoxyphenyl)methoxy]-5-[2-[3-methoxy-4-[[6-[3-(oxiran-2-yloxy)propoxy]naphthalen-2-yl]methoxy]phenyl]ethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 145298479 |
| Molecular Formula | C41H41NO7 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | [2-[(4-ethenoxyphenyl)methoxy]-5-[2-[3-methoxy-4-[[6-[3-(oxiran-2-yloxy)propoxy]naphthalen-2-yl]methoxy]phenyl]ethyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1cc(CCc2ccc(OCc3ccc4cc(OCCCOC5CO5)ccc4c3)c(OC)c2)ccc1OCc1ccc(OC=C)cc1 |
| InChI | InChI=1S/C41H41NO7/c1-3-44-36-14-8-31(9-15-36)26-47-38-17-10-29(21-35(38)25-42)5-6-30-11-18-39(40(23-30)43-2)48-27-32-7-12-34-24-37(16-13-33(34)22-32)45-19-4-20-46-41-28-49-41/h3,7-18,21-25,41-42H,1,4-6,19-20,26-28H2,2H3/b42-25+ |
| InChIKey | LWNSIOXNBHYXRK-QYXAQCCZSA-N |
| XLogP | 8.45 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|