C31H33NO6 — CID 129146528
[2-methanimidoyl-4-[[6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalen-2-yl]methoxy]phenyl] prop-2-enoate (PubChem CID 129146528) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is [2-methanimidoyl-4-[[6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalen-2-yl]methoxy]phenyl] prop-2-enoate.
| Compound Name | [2-methanimidoyl-4-[[6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalen-2-yl]methoxy]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 129146528 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [2-methanimidoyl-4-[[6-[3-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)propoxy]naphthalen-2-yl]methoxy]phenyl] prop-2-enoate |
| SMILES | [H]/N=C/c1cc(OCc2ccc3cc(OCCCOCC4CCC5OC5C4)ccc3c2)ccc1OC(=O)C=C |
| InChI | InChI=1S/C31H33NO6/c1-2-31(33)38-28-11-9-27(17-25(28)18-32)36-20-21-4-6-24-16-26(8-7-23(24)14-21)35-13-3-12-34-19-22-5-10-29-30(15-22)37-29/h2,4,6-9,11,14,16-18,22,29-30,32H,1,3,5,10,12-13,15,19-20H2/b32-18+ |
| InChIKey | WKZUUPPGHDSEEH-KCSSXMTESA-N |
| XLogP | 5.86 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|