C42H56O10 — CID 58220409
bis[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 58220409) has the molecular formula C42H56O10 and a molecular weight of 720.90 g/mol. Its IUPAC name is bis[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58220409 |
| Molecular Formula | C42H56O10 |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | bis[4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc(OCCCCOCC2CCC3OC3C2)cc1)C1CCC(C(=O)Oc2ccc(OCCCCOCC3CCC4OC4C3)cc2)CC1 |
| InChI | InChI=1S/C42H56O10/c43-41(49-35-15-11-33(12-16-35)47-23-3-1-21-45-27-29-5-19-37-39(25-29)51-37)31-7-9-32(10-8-31)42(44)50-36-17-13-34(14-18-36)48-24-4-2-22-46-28-30-6-20-38-40(26-30)52-38/h11-18,29-32,37-40H,1-10,19-28H2 |
| InChIKey | ORTZDUAWVRCGGJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|