C33H44O8 — CID 58220436
[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl] 4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate (PubChem CID 58220436) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is [4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl] 4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate.
| Compound Name | [4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl] 4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 58220436 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | [4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl] 4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
| SMILES | O=C(Oc1ccc(OCCCCCCOCC2CO2)cc1)c1ccc(OCCCCOCC2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C33H44O8/c34-33(40-29-14-12-28(13-15-29)37-19-4-2-1-3-17-36-23-30-24-39-30)26-8-10-27(11-9-26)38-20-6-5-18-35-22-25-7-16-31-32(21-25)41-31/h8-15,25,30-32H,1-7,16-24H2 |
| InChIKey | ISDRLFAGYIGNCH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|