C28H24ClNO7 — CID 118121849
[4-(4-cyanophenoxy)carbonylphenyl] 2-chloro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate (PubChem CID 118121849) has the molecular formula C28H24ClNO7 and a molecular weight of 521.95 g/mol. Its IUPAC name is [4-(4-cyanophenoxy)carbonylphenyl] 2-chloro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate.
| Compound Name | [4-(4-cyanophenoxy)carbonylphenyl] 2-chloro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 118121849 |
| Molecular Formula | C28H24ClNO7 |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | [4-(4-cyanophenoxy)carbonylphenyl] 2-chloro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
| SMILES | N#Cc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(OCCCCOCC4CO4)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H24ClNO7/c29-26-15-23(34-14-2-1-13-33-17-24-18-35-24)11-12-25(26)28(32)37-22-9-5-20(6-10-22)27(31)36-21-7-3-19(16-30)4-8-21/h3-12,15,24H,1-2,13-14,17-18H2 |
| InChIKey | QLNKPISWXYCVSY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 107.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|