C47H52F2O10 — CID 59318879
[7-[2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoate (PubChem CID 59318879) has the molecular formula C47H52F2O10 and a molecular weight of 814.92 g/mol. Its IUPAC name is [7-[2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoate.
| Compound Name | [7-[2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 59318879 |
| Molecular Formula | C47H52F2O10 |
| Molecular Weight | 814.92 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | [7-[2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoyl]oxy-9,9-dimethylfluoren-2-yl] 2-fluoro-4-[6-(oxiran-2-ylmethoxy)hexoxy]benzoate |
| SMILES | CC1(C)c2cc(OC(=O)c3ccc(OCCCCCCOCC4CO4)cc3F)ccc2-c2ccc(OC(=O)c3ccc(OCCCCCCOCC4CO4)cc3F)cc21 |
| InChI | InChI=1S/C47H52F2O10/c1-47(2)41-23-33(58-45(50)39-17-11-31(25-43(39)48)54-21-9-5-3-7-19-52-27-35-29-56-35)13-15-37(41)38-16-14-34(24-42(38)47)59-46(51)40-18-12-32(26-44(40)49)55-22-10-6-4-8-20-53-28-36-30-57-36/h11-18,23-26,35-36H,3-10,19-22,27-30H2,1-2H3 |
| InChIKey | VBJBZMKZZVKKND-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.92 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|