C22H24O6 — CID 58090323
[4-[2-(oxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate (PubChem CID 58090323) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [4-[2-(oxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate.
| Compound Name | [4-[2-(oxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 58090323 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [4-[2-(oxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate |
| SMILES | O=C(Oc1ccc(OCCC2CO2)cc1)c1ccc(OCCCC2CO2)cc1 |
| InChI | InChI=1S/C22H24O6/c23-22(16-3-5-17(6-4-16)24-12-1-2-20-14-26-20)28-19-9-7-18(8-10-19)25-13-11-21-15-27-21/h3-10,20-21H,1-2,11-15H2 |
| InChIKey | IESQAIXTMRWJRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|