C23H26O6 — CID 58309047
[4-[2-(2-methyloxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate (PubChem CID 58309047) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is [4-[2-(2-methyloxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate.
| Compound Name | [4-[2-(2-methyloxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 58309047 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [4-[2-(2-methyloxiran-2-yl)ethoxy]phenyl] 4-[3-(oxiran-2-yl)propoxy]benzoate |
| SMILES | CC1(CCOc2ccc(OC(=O)c3ccc(OCCCC4CO4)cc3)cc2)CO1 |
| InChI | InChI=1S/C23H26O6/c1-23(16-28-23)12-14-26-19-8-10-20(11-9-19)29-22(24)17-4-6-18(7-5-17)25-13-2-3-21-15-27-21/h4-11,21H,2-3,12-16H2,1H3 |
| InChIKey | FPZZUKFQBRRVRI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|