C24H26FNO3 — CID 54238503
(4-cyano-2-fluorophenyl) 4-[3-(4-methylcyclohexyl)propoxy]benzoate (PubChem CID 54238503) has the molecular formula C24H26FNO3 and a molecular weight of 395.47 g/mol. Its IUPAC name is (4-cyano-2-fluorophenyl) 4-[3-(4-methylcyclohexyl)propoxy]benzoate.
| Compound Name | (4-cyano-2-fluorophenyl) 4-[3-(4-methylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 54238503 |
| Molecular Formula | C24H26FNO3 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (4-cyano-2-fluorophenyl) 4-[3-(4-methylcyclohexyl)propoxy]benzoate |
| SMILES | CC1CCC(CCCOc2ccc(C(=O)Oc3ccc(C#N)cc3F)cc2)CC1 |
| InChI | InChI=1S/C24H26FNO3/c1-17-4-6-18(7-5-17)3-2-14-28-21-11-9-20(10-12-21)24(27)29-23-13-8-19(16-26)15-22(23)25/h8-13,15,17-18H,2-7,14H2,1H3 |
| InChIKey | QOHJDBYNIOHREK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|