C21H17F3O6 — CID 58220304
[4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 58220304) has the molecular formula C21H17F3O6 and a molecular weight of 422.36 g/mol. Its IUPAC name is [4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 58220304 |
| Molecular Formula | C21H17F3O6 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [4-[4-(trifluoromethoxy)phenoxy]carbonylphenyl] 7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | O=C(Oc1ccc(OC(F)(F)F)cc1)c1ccc(OC(=O)C2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C21H17F3O6/c22-21(23,24)30-16-8-6-15(7-9-16)27-19(25)12-1-4-14(5-2-12)28-20(26)13-3-10-17-18(11-13)29-17/h1-2,4-9,13,17-18H,3,10-11H2 |
| InChIKey | HDMPKHWNUANDBW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|