C24H27NO3 — CID 88957884
4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzonitrile (PubChem CID 88957884) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 88957884 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-[4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]phenyl]benzonitrile |
| SMILES | CCCC(OCC1CCC2OC2C1)Oc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-2-3-24(26-16-18-6-13-22-23(14-18)28-22)27-21-11-9-20(10-12-21)19-7-4-17(15-25)5-8-19/h4-5,7-12,18,22-24H,2-3,6,13-14,16H2,1H3 |
| InChIKey | JLRXDYZLGABECO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|