C27H33F3O3 — CID 59048923
(4-ethylphenyl) 4-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-2-fluorobenzoate (PubChem CID 59048923) has the molecular formula C27H33F3O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is (4-ethylphenyl) 4-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-2-fluorobenzoate.
| Compound Name | (4-ethylphenyl) 4-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 59048923 |
| Molecular Formula | C27H33F3O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (4-ethylphenyl) 4-[1,1-difluoro-3-(4-propylcyclohexyl)propoxy]-2-fluorobenzoate |
| SMILES | CCCC1CCC(CCC(F)(F)Oc2ccc(C(=O)Oc3ccc(CC)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H33F3O3/c1-3-5-20-6-8-21(9-7-20)16-17-27(29,30)33-23-14-15-24(25(28)18-23)26(31)32-22-12-10-19(4-2)11-13-22/h10-15,18,20-21H,3-9,16-17H2,1-2H3 |
| InChIKey | IUSVWINYQWFWFS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|