C36H31F3O10 — CID 59790874
[7-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-9-(trifluoromethyl)-9H-fluoren-2-yl] 4-(oxiran-2-ylmethoxymethoxy)benzoate (PubChem CID 59790874) has the molecular formula C36H31F3O10 and a molecular weight of 680.63 g/mol. Its IUPAC name is [7-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-9-(trifluoromethyl)-9H-fluoren-2-yl] 4-(oxiran-2-ylmethoxymethoxy)benzoate.
| Compound Name | [7-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-9-(trifluoromethyl)-9H-fluoren-2-yl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59790874 |
| Molecular Formula | C36H31F3O10 |
| Molecular Weight | 680.63 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | [7-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-9-(trifluoromethyl)-9H-fluoren-2-yl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
| SMILES | O=C(Oc1ccc2c(c1)C(C(F)(F)F)c1cc(OCOc3ccc(OCOCC4CO4)cc3)ccc1-2)c1ccc(OCOCC2CO2)cc1 |
| InChI | InChI=1S/C36H31F3O10/c37-36(38,39)34-32-13-26(48-21-47-25-7-5-24(6-8-25)46-20-42-16-29-18-44-29)9-11-30(32)31-12-10-27(14-33(31)34)49-35(40)22-1-3-23(4-2-22)45-19-41-15-28-17-43-28/h1-14,28-29,34H,15-21H2 |
| InChIKey | XHTODVUVBNZIEQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|