C32H38O6 — CID 87442404
2-[2-[2-butan-2-yl-4-[4-[4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane (PubChem CID 87442404) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-[2-[2-butan-2-yl-4-[4-[4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[2-[2-butan-2-yl-4-[4-[4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 87442404 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 2-[2-[2-butan-2-yl-4-[4-[4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]phenyl]phenoxy]ethoxymethyl]oxirane |
| SMILES | CCC(C)c1cc(-c2ccc(-c3ccc(OCCOCC4CO4)cc3)cc2)ccc1OCCOCC1CO1 |
| InChI | InChI=1S/C32H38O6/c1-3-23(2)31-18-27(10-13-32(31)36-17-15-34-20-30-22-38-30)26-6-4-24(5-7-26)25-8-11-28(12-9-25)35-16-14-33-19-29-21-37-29/h4-13,18,23,29-30H,3,14-17,19-22H2,1-2H3 |
| InChIKey | UUYUFSYAYNYVDV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|