C15H22O5 — CID 18939129
4-[2-(oxiran-2-ylmethoxy)ethoxy]benzaldehyde;propan-2-ol (PubChem CID 18939129) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[2-(oxiran-2-ylmethoxy)ethoxy]benzaldehyde;propan-2-ol.
| Compound Name | 4-[2-(oxiran-2-ylmethoxy)ethoxy]benzaldehyde;propan-2-ol |
|---|---|
| PubChem CID | 18939129 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[2-(oxiran-2-ylmethoxy)ethoxy]benzaldehyde;propan-2-ol |
| SMILES | CC(C)O.O=Cc1ccc(OCCOCC2CO2)cc1 |
| InChI | InChI=1S/C12H14O4.C3H8O/c13-7-10-1-3-11(4-2-10)15-6-5-14-8-12-9-16-12;1-3(2)4/h1-4,7,12H,5-6,8-9H2;3-4H,1-2H3 |
| InChIKey | NRUFPCCEAFAYHE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|