C27H26F2O6 — CID 21036009
2-[[4-[[2-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]methyl]oxirane (PubChem CID 21036009) has the molecular formula C27H26F2O6 and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-[[4-[[2-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[[2-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 21036009 |
| Molecular Formula | C27H26F2O6 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[[4-[[2-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenyl]methoxy]phenoxy]methyl]phenoxy]methyl]oxirane |
| SMILES | FC(F)c1cc(OCc2ccc(OCC3CO3)cc2)ccc1OCc1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C27H26F2O6/c28-27(29)25-11-22(30-12-18-1-5-20(6-2-18)31-14-23-16-33-23)9-10-26(25)35-13-19-3-7-21(8-4-19)32-15-24-17-34-24/h1-11,23-24,27H,12-17H2 |
| InChIKey | FMHGPYUPQPYHHY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|