C20H20O7 — CID 118525283
2-[2,5-bis(oxiran-2-ylmethoxy)phenyl]-2-(2-hydroxyphenyl)acetic acid (PubChem CID 118525283) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[2,5-bis(oxiran-2-ylmethoxy)phenyl]-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-[2,5-bis(oxiran-2-ylmethoxy)phenyl]-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 118525283 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[2,5-bis(oxiran-2-ylmethoxy)phenyl]-2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(c1ccccc1O)c1cc(OCC2CO2)ccc1OCC1CO1 |
| InChI | InChI=1S/C20H20O7/c21-17-4-2-1-3-15(17)19(20(22)23)16-7-12(24-8-13-9-25-13)5-6-18(16)27-11-14-10-26-14/h1-7,13-14,19,21H,8-11H2,(H,22,23) |
| InChIKey | NPLAPVZLJKTXHV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|