C47H60O10 — CID 59601917
[6-[3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoyloxy]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoate (PubChem CID 59601917) has the molecular formula C47H60O10 and a molecular weight of 784.99 g/mol. Its IUPAC name is [6-[3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoyloxy]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoate.
| Compound Name | [6-[3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoyloxy]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 59601917 |
| Molecular Formula | C47H60O10 |
| Molecular Weight | 784.99 g/mol |
| Exact Mass | 784.42 |
| IUPAC Name | [6-[3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoyloxy]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-[4-[6-(oxiran-2-ylmethoxy)hexoxy]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(OCCCCCCOCC2CO2)cc1)Oc1ccc(OC(=O)CCc2ccc(OCCCCCCOCC3CO3)cc2)c2c1C1CCC2C1 |
| InChI | InChI=1S/C47H60O10/c48-44(23-13-34-9-17-38(18-10-34)52-27-7-3-1-5-25-50-30-40-32-54-40)56-42-21-22-43(47-37-16-15-36(29-37)46(42)47)57-45(49)24-14-35-11-19-39(20-12-35)53-28-8-4-2-6-26-51-31-41-33-55-41/h9-12,17-22,36-37,40-41H,1-8,13-16,23-33H2 |
| InChIKey | KLOCKDDQCYCAFO-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.99 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|