C32H26O8 — CID 129281731
[3-ethyl-4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]oxyphenyl] (E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoate (PubChem CID 129281731) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is [3-ethyl-4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]oxyphenyl] (E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoate.
| Compound Name | [3-ethyl-4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]oxyphenyl] (E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129281731 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | [3-ethyl-4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]oxyphenyl] (E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(/C=C/C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(OC(=O)C=C)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C32H26O8/c1-4-24-21-27(39-31(35)19-11-22-7-13-25(14-8-22)37-29(33)5-2)17-18-28(24)40-32(36)20-12-23-9-15-26(16-10-23)38-30(34)6-3/h5-21H,2-4H2,1H3/b19-11+,20-12+ |
| InChIKey | ZRHBZGHREZLCQY-AYKLPDECSA-N |
| XLogP | 5.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|