C24H18O7 — CID 123382441
[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]prop-2-enoyl]phenyl] prop-2-enoate (PubChem CID 123382441) has the molecular formula C24H18O7 and a molecular weight of 418.40 g/mol. Its IUPAC name is [4-[3-[3,4-di(prop-2-enoyloxy)phenyl]prop-2-enoyl]phenyl] prop-2-enoate.
| Compound Name | [4-[3-[3,4-di(prop-2-enoyloxy)phenyl]prop-2-enoyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 123382441 |
| Molecular Formula | C24H18O7 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [4-[3-[3,4-di(prop-2-enoyloxy)phenyl]prop-2-enoyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)C=Cc2ccc(OC(=O)C=C)c(OC(=O)C=C)c2)cc1 |
| InChI | InChI=1S/C24H18O7/c1-4-22(26)29-18-11-9-17(10-12-18)19(25)13-7-16-8-14-20(30-23(27)5-2)21(15-16)31-24(28)6-3/h4-15H,1-3H2 |
| InChIKey | YJGQEGUWMJUPFK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|