C28H22O10 — CID 123414988
[2,4-di(prop-2-enoyloxy)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]-2-methylprop-2-enoate (PubChem CID 123414988) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is [2,4-di(prop-2-enoyloxy)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]-2-methylprop-2-enoate.
| Compound Name | [2,4-di(prop-2-enoyloxy)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123414988 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | [2,4-di(prop-2-enoyloxy)phenyl] 3-[3,4-di(prop-2-enoyloxy)phenyl]-2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)C(C)=Cc2ccc(OC(=O)C=C)c(OC(=O)C=C)c2)c(OC(=O)C=C)c1 |
| InChI | InChI=1S/C28H22O10/c1-6-24(29)34-19-11-13-21(23(16-19)37-27(32)9-4)38-28(33)17(5)14-18-10-12-20(35-25(30)7-2)22(15-18)36-26(31)8-3/h6-16H,1-4H2,5H3 |
| InChIKey | ZCSRWIXAQFCHKD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|