C24H26O2 — CID 170021555
(3R,3aR,6R,6aR)-3,6-bis[2-(4-methylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 170021555) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3,6-bis[2-(4-methylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aR,6R,6aR)-3,6-bis[2-(4-methylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 170021555 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3R,3aR,6R,6aR)-3,6-bis[2-(4-methylphenyl)ethenyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | Cc1ccc(C=C[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3C=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26O2/c1-17-3-7-19(8-4-17)11-13-21-15-25-24-22(16-26-23(21)24)14-12-20-9-5-18(2)6-10-20/h3-14,21-24H,15-16H2,1-2H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | LTWYPIBQYQHSHH-MOUTVQLLSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |