About 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol
2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol (PubChem CID 155815165) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol |
| PubChem CID | 155815165 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol |
| SMILES | Cc1ccc(/C=C/[C@H]2C[C@@H]2CCO)cc1 |
| InChI | InChI=1S/C14H18O/c1-11-2-4-12(5-3-11)6-7-13-10-14(13)8-9-15/h2-7,13-15H,8-10H2,1H3/b7-6+/t13-,14-/m0/s1 |
| InChIKey | VUPGNPPJXABLLJ-AGKLADILSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol?
The IUPAC name of 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol (CID 155815165) is 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol.
What is the SMILES notation for 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol?
The canonical SMILES for 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol is Cc1ccc(/C=C/[C@H]2C[C@@H]2CCO)cc1.
What is the InChIKey of 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol?
The InChIKey is VUPGNPPJXABLLJ-AGKLADILSA-N. The full InChI is InChI=1S/C14H18O/c1-11-2-4-12(5-3-11)6-7-13-10-14(13)8-9-15/h2-7,13-15H,8-10H2,1H3/b7-6+/t13-,14-/m0/s1.
What are the key properties of 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol?
2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol has a molecular weight of 202.30 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopropyl]ethanol is sourced from PubChem (CID 155815165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).