C16H18O2S — CID 20696708
2-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]-5-methylsulfanyl-1,3-dioxane (PubChem CID 20696708) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is 2-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]-5-methylsulfanyl-1,3-dioxane.
| Compound Name | 2-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]-5-methylsulfanyl-1,3-dioxane |
|---|---|
| PubChem CID | 20696708 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]-5-methylsulfanyl-1,3-dioxane |
| SMILES | CSC1COC(C#C/C=C/c2ccc(C)cc2)OC1 |
| InChI | InChI=1S/C16H18O2S/c1-13-7-9-14(10-8-13)5-3-4-6-16-17-11-15(19-2)12-18-16/h3,5,7-10,15-16H,11-12H2,1-2H3/b5-3+ |
| InChIKey | NTUVDIDNRKUXMN-HWKANZROSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|