C14H18O2 — CID 6043851
5,5-dimethyl-2-[(E)-2-phenylethenyl]-1,3-dioxane (PubChem CID 6043851) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(E)-2-phenylethenyl]-1,3-dioxane.
| Compound Name | 5,5-dimethyl-2-[(E)-2-phenylethenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 6043851 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5,5-dimethyl-2-[(E)-2-phenylethenyl]-1,3-dioxane |
| SMILES | CC1(C)COC(/C=C/c2ccccc2)OC1 |
| InChI | InChI=1S/C14H18O2/c1-14(2)10-15-13(16-11-14)9-8-12-6-4-3-5-7-12/h3-9,13H,10-11H2,1-2H3/b9-8+ |
| InChIKey | RYURQFKFHVTVFW-CMDGGOBGSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |