C32H38O4 — CID 10528957
2-[4-[(1E,3E,5E,7E)-8-[4-(5,5-dimethyl-1,3-dioxan-2-yl)phenyl]octa-1,3,5,7-tetraenyl]phenyl]-5,5-dimethyl-1,3-dioxane (PubChem CID 10528957) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[4-[(1E,3E,5E,7E)-8-[4-(5,5-dimethyl-1,3-dioxan-2-yl)phenyl]octa-1,3,5,7-tetraenyl]phenyl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-[4-[(1E,3E,5E,7E)-8-[4-(5,5-dimethyl-1,3-dioxan-2-yl)phenyl]octa-1,3,5,7-tetraenyl]phenyl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 10528957 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-[4-[(1E,3E,5E,7E)-8-[4-(5,5-dimethyl-1,3-dioxan-2-yl)phenyl]octa-1,3,5,7-tetraenyl]phenyl]-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(c2ccc(/C=C/C=C/C=C/C=C/c3ccc(C4OCC(C)(C)CO4)cc3)cc2)OC1 |
| InChI | InChI=1S/C32H38O4/c1-31(2)21-33-29(34-22-31)27-17-13-25(14-18-27)11-9-7-5-6-8-10-12-26-15-19-28(20-16-26)30-35-23-32(3,4)24-36-30/h5-20,29-30H,21-24H2,1-4H3/b7-5+,8-6+,11-9+,12-10+ |
| InChIKey | BHPXSGVLWDJPLR-HCNIIHBUSA-N |
| XLogP | 7.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|