C28H20F26O2 — CID 11285986
2-[(E)-2-phenylethenyl]-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane (PubChem CID 11285986) has the molecular formula C28H20F26O2 and a molecular weight of 882.41 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane.
| Compound Name | 2-[(E)-2-phenylethenyl]-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane |
|---|---|
| PubChem CID | 11285986 |
| Molecular Formula | C28H20F26O2 |
| Molecular Weight | 882.41 g/mol |
| Exact Mass | 882.10 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COC(/C=C/c2ccccc2)OC1 |
| InChI | InChI=1S/C28H20F26O2/c29-17(30,19(33,34)21(37,38)23(41,42)25(45,46)27(49,50)51)10-8-16(12-55-15(56-13-16)7-6-14-4-2-1-3-5-14)9-11-18(31,32)20(35,36)22(39,40)24(43,44)26(47,48)28(52,53)54/h1-7,15H,8-13H2/b7-6+ |
| InChIKey | KKQIYRZOBDWYCT-VOTSOKGWSA-N |
| XLogP | 12.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.41 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|